C30H46N6O4Si — CID 90040931
tert-butyl N-[3-[[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-ethylcarbamate (PubChem CID 90040931) has the molecular formula C30H46N6O4Si and a molecular weight of 582.82 g/mol. Its IUPAC name is tert-butyl N-[3-[[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[3-[[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 90040931 |
| Molecular Formula | C30H46N6O4Si |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | tert-butyl N-[3-[[7-(tert-butylcarbamoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1cccc(Nc2cnc3c(n2)c(C(=O)NC(C)(C)C)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C30H46N6O4Si/c1-11-36(28(38)40-30(5,6)7)22-14-12-13-21(17-22)32-24-18-31-26-25(33-24)23(27(37)34-29(2,3)4)19-35(26)20-39-15-16-41(8,9)10/h12-14,17-19H,11,15-16,20H2,1-10H3,(H,32,33)(H,34,37) |
| InChIKey | GFAYRULNFULZHD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|