C22H32N6O3Si — CID 90040937
N-(1-hydroxy-2-methylpropan-2-yl)-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 90040937) has the molecular formula C22H32N6O3Si and a molecular weight of 456.62 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 90040937 |
| Molecular Formula | C22H32N6O3Si |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-(pyridin-3-ylamino)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)(CO)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Nc3cccnc3)nc12 |
| InChI | InChI=1S/C22H32N6O3Si/c1-22(2,14-29)27-21(30)17-13-28(15-31-9-10-32(3,4)5)20-19(17)26-18(12-24-20)25-16-7-6-8-23-11-16/h6-8,11-13,29H,9-10,14-15H2,1-5H3,(H,25,26)(H,27,30) |
| InChIKey | YAFSQBDMABSKEB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|