C27H12F15NO6 — CID 90041039
(2,3,4,5,6-pentafluorophenyl) 3-[bis[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl]amino]propanoate (PubChem CID 90041039) has the molecular formula C27H12F15NO6 and a molecular weight of 731.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[bis[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl]amino]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[bis[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl]amino]propanoate |
|---|---|
| PubChem CID | 90041039 |
| Molecular Formula | C27H12F15NO6 |
| Molecular Weight | 731.36 g/mol |
| Exact Mass | 731.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[bis[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propyl]amino]propanoate |
| SMILES | O=C(CCN(CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H12F15NO6/c28-10-13(31)19(37)25(20(38)14(10)32)47-7(44)1-4-43(5-2-8(45)48-26-21(39)15(33)11(29)16(34)22(26)40)6-3-9(46)49-27-23(41)17(35)12(30)18(36)24(27)42/h1-6H2 |
| InChIKey | SNVWVZUJRPOVPH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.36 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|