C15H15F3O5 — CID 90041198
2,2,5-trimethyl-5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dioxane-4,6-dione (PubChem CID 90041198) has the molecular formula C15H15F3O5 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2,2,5-trimethyl-5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2,5-trimethyl-5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 90041198 |
| Molecular Formula | C15H15F3O5 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2,2,5-trimethyl-5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C)(Cc2ccc(OC(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H15F3O5/c1-13(2)22-11(19)14(3,12(20)23-13)8-9-4-6-10(7-5-9)21-15(16,17)18/h4-7H,8H2,1-3H3 |
| InChIKey | KATFNEJBCWCOSW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|