C23H34N6O3Si — CID 90041616
N-(1-hydroxy-2-methylpropan-2-yl)-2-[(5-methyl-2-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 90041616) has the molecular formula C23H34N6O3Si and a molecular weight of 470.65 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-2-[(5-methyl-2-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-[(5-methyl-2-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 90041616 |
| Molecular Formula | C23H34N6O3Si |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-[(5-methyl-2-pyridinyl)amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cc1ccc(Nc2cnc3c(n2)c(C(=O)NC(C)(C)CO)cn3COCC[Si](C)(C)C)nc1 |
| InChI | InChI=1S/C23H34N6O3Si/c1-16-7-8-18(24-11-16)26-19-12-25-21-20(27-19)17(22(31)28-23(2,3)14-30)13-29(21)15-32-9-10-33(4,5)6/h7-8,11-13,30H,9-10,14-15H2,1-6H3,(H,28,31)(H,24,26,27) |
| InChIKey | GUDYFGPMDIDROX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|