C17H17F2NO3 — CID 90041645
5-[3-(difluoromethyl)phenyl]-6-methyl-4-oxo-2-propan-2-yl-1H-pyridine-3-carboxylic acid (PubChem CID 90041645) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is 5-[3-(difluoromethyl)phenyl]-6-methyl-4-oxo-2-propan-2-yl-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-[3-(difluoromethyl)phenyl]-6-methyl-4-oxo-2-propan-2-yl-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90041645 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 5-[3-(difluoromethyl)phenyl]-6-methyl-4-oxo-2-propan-2-yl-1H-pyridine-3-carboxylic acid |
| SMILES | Cc1[nH]c(C(C)C)c(C(=O)O)c(=O)c1-c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C17H17F2NO3/c1-8(2)14-13(17(22)23)15(21)12(9(3)20-14)10-5-4-6-11(7-10)16(18)19/h4-8,16H,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | ZPMRPVHMCCZJCJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |