C25H31N3O — CID 90041799
5-[(2R)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 90041799) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 5-[(2R)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-[(2R)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 90041799 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 5-[(2R)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2C[C@H](OCC2CCC2)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C25H31N3O/c1-18-6-7-23-21(14-18)22-15-27(2)13-10-24(22)28(23)16-25(20-8-11-26-12-9-20)29-17-19-4-3-5-19/h6-9,11-12,14,19,25H,3-5,10,13,15-17H2,1-2H3/t25-/m0/s1 |
| InChIKey | CTDXGPYUCJOQAF-VWLOTQADSA-N |
| XLogP | 4.89 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|