About 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine
3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 90042076) has the molecular formula C20H32BrF3N2
and a molecular weight of 437.39 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine |
| PubChem CID | 90042076 |
| Molecular Formula | C20H32BrF3N2 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | CCN(C(C)C)C(C)C.FC(F)(F)CN1CCC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H13BrF3N.C8H19N/c13-11-3-1-9(2-4-11)10-5-6-17(7-10)8-12(14,15)16;1-6-9(7(2)3)8(4)5/h1-4,10H,5-8H2;7-8H,6H2,1-5H3 |
| InChIKey | MNFDMELIUAFEAK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine?
The IUPAC name of 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine (CID 90042076) is 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine?
The canonical SMILES for 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine is CCN(C(C)C)C(C)C.FC(F)(F)CN1CCC(c2ccc(Br)cc2)C1.
What is the InChIKey of 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine?
The InChIKey is MNFDMELIUAFEAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF3N.C8H19N/c13-11-3-1-9(2-4-11)10-5-6-17(7-10)8-12(14,15)16;1-6-9(7(2)3)8(4)5/h1-4,10H,5-8H2;7-8H,6H2,1-5H3.
What are the key properties of 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine?
3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine has a molecular weight of 437.39 g/mol, XLogP of 5.93, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-1-(2,2,2-trifluoroethyl)pyrrolidine;N-ethyl-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 90042076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).