C20H23N3O3S — CID 90042096
[2-(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-3-ylethyl] methanesulfonate (PubChem CID 90042096) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is [2-(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-3-ylethyl] methanesulfonate.
| Compound Name | [2-(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-3-ylethyl] methanesulfonate |
|---|---|
| PubChem CID | 90042096 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [2-(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-3-ylethyl] methanesulfonate |
| SMILES | CN1CCc2c(c3ccccc3n2CC(OS(C)(=O)=O)c2cccnc2)C1 |
| InChI | InChI=1S/C20H23N3O3S/c1-22-11-9-19-17(13-22)16-7-3-4-8-18(16)23(19)14-20(26-27(2,24)25)15-6-5-10-21-12-15/h3-8,10,12,20H,9,11,13-14H2,1-2H3 |
| InChIKey | SECOMFWDZUAVQT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|