C18H14F3N3O3S — CID 90042112
3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzenesulfonic acid (PubChem CID 90042112) has the molecular formula C18H14F3N3O3S and a molecular weight of 409.39 g/mol. Its IUPAC name is 3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzenesulfonic acid.
| Compound Name | 3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90042112 |
| Molecular Formula | C18H14F3N3O3S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]benzenesulfonic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cccc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C18H14F3N3O3S/c1-11-7-13(12-3-2-4-15(10-12)28(25,26)27)9-14(8-11)23-17-22-6-5-16(24-17)18(19,20)21/h2-10H,1H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | AJUPERZFUKNNAW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|