C31H34ClF2N3O6Si — CID 90042306
(3S)-6-[6-chloro-5-[4-(3,5-difluoro-2-methoxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90042306) has the molecular formula C31H34ClF2N3O6Si and a molecular weight of 646.16 g/mol. Its IUPAC name is (3S)-6-[6-chloro-5-[4-(3,5-difluoro-2-methoxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S)-6-[6-chloro-5-[4-(3,5-difluoro-2-methoxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90042306 |
| Molecular Formula | C31H34ClF2N3O6Si |
| Molecular Weight | 646.16 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | (3S)-6-[6-chloro-5-[4-(3,5-difluoro-2-methoxyphenyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | COc1c(F)cc(F)cc1-c1ccc(-c2nc3nc(OC4COC5C4OC[C@@H]5O)n(COCC[Si](C)(C)C)c3cc2Cl)cc1 |
| InChI | InChI=1S/C31H34ClF2N3O6Si/c1-39-27-20(11-19(33)12-22(27)34)17-5-7-18(8-6-17)26-21(32)13-23-30(35-26)36-31(37(23)16-40-9-10-44(2,3)4)43-25-15-42-28-24(38)14-41-29(25)28/h5-8,11-13,24-25,28-29,38H,9-10,14-16H2,1-4H3/t24-,25?,28?,29?/m0/s1 |
| InChIKey | WYNRKERPPDLSDZ-KJWZKSEYSA-N |
| XLogP | 5.92 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.16 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|