C6H8N6O2 — CID 90042500
(3S,3aR,6R,6aR)-3,6-diazido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 90042500) has the molecular formula C6H8N6O2 and a molecular weight of 196.17 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3,6-diazido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-3,6-diazido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 90042500 |
| Molecular Formula | C6H8N6O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S,3aR,6R,6aR)-3,6-diazido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | [N-]=[N+]=N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C6H8N6O2/c7-11-9-3-1-13-6-4(10-12-8)2-14-5(3)6/h3-6H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | VWLQAMUFRAITOR-JGWLITMVSA-N |
| XLogP | 1.14 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|