C16H30O5Si — CID 90042502
ethyl 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetate (PubChem CID 90042502) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is ethyl 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetate.
| Compound Name | ethyl 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetate |
|---|---|
| PubChem CID | 90042502 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | ethyl 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetate |
| SMILES | CCOC(=O)CC1CO[C@H]2[C@@H]1OC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O5Si/c1-7-18-13(17)8-11-9-19-15-12(10-20-14(11)15)21-22(5,6)16(2,3)4/h11-12,14-15H,7-10H2,1-6H3/t11?,12-,14-,15-/m1/s1 |
| InChIKey | FEBGHADQBPWTAF-ZJPTYJIISA-N |
| XLogP | 2.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|