C24H27N3O3 — CID 90042707
(E)-4-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethoxy]but-2-enoic acid (PubChem CID 90042707) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-4-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethoxy]but-2-enoic acid.
| Compound Name | (E)-4-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 90042707 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (E)-4-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-pyridin-4-ylethoxy]but-2-enoic acid |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(OC/C=C/C(=O)O)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C24H27N3O3/c1-17-5-6-21-19(14-17)20-15-26(2)12-9-22(20)27(21)16-23(18-7-10-25-11-8-18)30-13-3-4-24(28)29/h3-8,10-11,14,23H,9,12-13,15-16H2,1-2H3,(H,28,29)/b4-3+ |
| InChIKey | JUZRFENMPGOCMW-ONEGZZNKSA-N |
| XLogP | 3.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|