C28H33F3N4O3SSi — CID 90042790
tert-butyl-dimethyl-[2-[3-[[5-methyl-3-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1,2,4-triazol-1-yl]methyl]phenoxy]ethoxy]silane (PubChem CID 90042790) has the molecular formula C28H33F3N4O3SSi and a molecular weight of 590.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[3-[[5-methyl-3-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1,2,4-triazol-1-yl]methyl]phenoxy]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[3-[[5-methyl-3-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1,2,4-triazol-1-yl]methyl]phenoxy]ethoxy]silane |
|---|---|
| PubChem CID | 90042790 |
| Molecular Formula | C28H33F3N4O3SSi |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | tert-butyl-dimethyl-[2-[3-[[5-methyl-3-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]-1,2,4-triazol-1-yl]methyl]phenoxy]ethoxy]silane |
| SMILES | Cc1nc(-c2nc(-c3ccc(OC(F)(F)F)cc3)cs2)nn1Cc1cccc(OCCO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H33F3N4O3SSi/c1-19-32-25(26-33-24(18-39-26)21-10-12-22(13-11-21)38-28(29,30)31)34-35(19)17-20-8-7-9-23(16-20)36-14-15-37-40(5,6)27(2,3)4/h7-13,16,18H,14-15,17H2,1-6H3 |
| InChIKey | DQNSSRCWLPKNGA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|