About 1,6-dihydropyrido[1,2-a]pyrimidin-4-one
1,6-dihydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 90044482) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 1,6-dihydropyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1,6-dihydropyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 90044482 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 1,6-dihydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C1C=CNC2=CC=CCN12 |
| InChI | InChI=1S/C8H8N2O/c11-8-4-5-9-7-3-1-2-6-10(7)8/h1-5,9H,6H2 |
| InChIKey | YSNBDOPGOLSXMI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dihydropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 1,6-dihydropyrido[1,2-a]pyrimidin-4-one (CID 90044482) is 1,6-dihydropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 1,6-dihydropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 1,6-dihydropyrido[1,2-a]pyrimidin-4-one is O=C1C=CNC2=CC=CCN12.
What is the InChIKey of 1,6-dihydropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is YSNBDOPGOLSXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-8-4-5-9-7-3-1-2-6-10(7)8/h1-5,9H,6H2.
What are the key properties of 1,6-dihydropyrido[1,2-a]pyrimidin-4-one?
1,6-dihydropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 148.16 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 90044482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).