C18H16BrClN2O2 — CID 9004452
(3S)-N-(4-bromo-3-chloro-2-methylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 9004452) has the molecular formula C18H16BrClN2O2 and a molecular weight of 407.70 g/mol. Its IUPAC name is (3S)-N-(4-bromo-3-chloro-2-methylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(4-bromo-3-chloro-2-methylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9004452 |
| Molecular Formula | C18H16BrClN2O2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (3S)-N-(4-bromo-3-chloro-2-methylphenyl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | Cc1c(NC(=O)[C@H]2CC(=O)N(c3ccccc3)C2)ccc(Br)c1Cl |
| InChI | InChI=1S/C18H16BrClN2O2/c1-11-15(8-7-14(19)17(11)20)21-18(24)12-9-16(23)22(10-12)13-5-3-2-4-6-13/h2-8,12H,9-10H2,1H3,(H,21,24)/t12-/m0/s1 |
| InChIKey | DTEPRVBYRUJCAQ-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |