C25H50N2O7Si2 — CID 90044603
tert-butyl 9-hydroxy-8-[2-(methylamino)-2-oxoethyl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate (PubChem CID 90044603) has the molecular formula C25H50N2O7Si2 and a molecular weight of 546.85 g/mol. Its IUPAC name is tert-butyl 9-hydroxy-8-[2-(methylamino)-2-oxoethyl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate.
| Compound Name | tert-butyl 9-hydroxy-8-[2-(methylamino)-2-oxoethyl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate |
|---|---|
| PubChem CID | 90044603 |
| Molecular Formula | C25H50N2O7Si2 |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | tert-butyl 9-hydroxy-8-[2-(methylamino)-2-oxoethyl]-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-[1,3,5,2,4]trioxadisilocino[7,6-b]pyrrole-7-carboxylate |
| SMILES | CNC(=O)CC1C(O)C2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OCC2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H50N2O7Si2/c1-15(2)35(16(3)4)31-14-20-23(33-36(34-35,17(5)6)18(7)8)22(29)19(13-21(28)26-12)27(20)24(30)32-25(9,10)11/h15-20,22-23,29H,13-14H2,1-12H3,(H,26,28) |
| InChIKey | ZVAJAINXTVRZLH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|