About 2-(4-methylanilino)ethyl methanesulfonate
2-(4-methylanilino)ethyl methanesulfonate (PubChem CID 90045939) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-(4-methylanilino)ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-(4-methylanilino)ethyl methanesulfonate |
| PubChem CID | 90045939 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-(4-methylanilino)ethyl methanesulfonate |
| SMILES | Cc1ccc(NCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15NO3S/c1-9-3-5-10(6-4-9)11-7-8-14-15(2,12)13/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | RIEYXMRHENLQGG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylanilino)ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylanilino)ethyl methanesulfonate?
The IUPAC name of 2-(4-methylanilino)ethyl methanesulfonate (CID 90045939) is 2-(4-methylanilino)ethyl methanesulfonate.
What is the SMILES notation for 2-(4-methylanilino)ethyl methanesulfonate?
The canonical SMILES for 2-(4-methylanilino)ethyl methanesulfonate is Cc1ccc(NCCOS(C)(=O)=O)cc1.
What is the InChIKey of 2-(4-methylanilino)ethyl methanesulfonate?
The InChIKey is RIEYXMRHENLQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-9-3-5-10(6-4-9)11-7-8-14-15(2,12)13/h3-6,11H,7-8H2,1-2H3.
What are the key properties of 2-(4-methylanilino)ethyl methanesulfonate?
2-(4-methylanilino)ethyl methanesulfonate has a molecular weight of 229.30 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylanilino)ethyl methanesulfonate is sourced from PubChem (CID 90045939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).