About N-but-3-en-2-ylidene-N'-methylmethanimidamide
N-but-3-en-2-ylidene-N'-methylmethanimidamide (PubChem CID 90046057) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is N-but-3-en-2-ylidene-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-but-3-en-2-ylidene-N'-methylmethanimidamide |
| PubChem CID | 90046057 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | N-but-3-en-2-ylidene-N'-methylmethanimidamide |
| SMILES | C=C/C(C)=N/C=N/C |
| InChI | InChI=1S/C6H10N2/c1-4-6(2)8-5-7-3/h4-5H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | GDLWVALSBAQZKX-KQQUZDAGSA-N |
| XLogP | 1.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-en-2-ylidene-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-en-2-ylidene-N'-methylmethanimidamide?
The IUPAC name of N-but-3-en-2-ylidene-N'-methylmethanimidamide (CID 90046057) is N-but-3-en-2-ylidene-N'-methylmethanimidamide.
What is the SMILES notation for N-but-3-en-2-ylidene-N'-methylmethanimidamide?
The canonical SMILES for N-but-3-en-2-ylidene-N'-methylmethanimidamide is C=C/C(C)=N/C=N/C.
What is the InChIKey of N-but-3-en-2-ylidene-N'-methylmethanimidamide?
The InChIKey is GDLWVALSBAQZKX-KQQUZDAGSA-N. The full InChI is InChI=1S/C6H10N2/c1-4-6(2)8-5-7-3/h4-5H,1H2,2-3H3/b7-5+,8-6+.
What are the key properties of N-but-3-en-2-ylidene-N'-methylmethanimidamide?
N-but-3-en-2-ylidene-N'-methylmethanimidamide has a molecular weight of 110.16 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-en-2-ylidene-N'-methylmethanimidamide is sourced from PubChem (CID 90046057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).