C19H35BO2 — CID 90046254
(1S,2S,6S,8S)-2,9,9-trimethyl-4-(3,5,5-trimethylhexyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 90046254) has the molecular formula C19H35BO2 and a molecular weight of 306.30 g/mol. Its IUPAC name is (1S,2S,6S,8S)-2,9,9-trimethyl-4-(3,5,5-trimethylhexyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6S,8S)-2,9,9-trimethyl-4-(3,5,5-trimethylhexyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 90046254 |
| Molecular Formula | C19H35BO2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | (1S,2S,6S,8S)-2,9,9-trimethyl-4-(3,5,5-trimethylhexyl)-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC(CCB1O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)CC(C)(C)C |
| InChI | InChI=1S/C19H35BO2/c1-13(12-17(2,3)4)8-9-20-21-16-11-14-10-15(18(14,5)6)19(16,7)22-20/h13-16H,8-12H2,1-7H3/t13?,14-,15-,16-,19-/m0/s1 |
| InChIKey | VTYCQTUHCNFCQU-GEAMSBSCSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|