C15H15NO4 — CID 90046409
methyl 3-(5,6-dimethoxy-3-pyridinyl)benzoate (PubChem CID 90046409) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 3-(5,6-dimethoxy-3-pyridinyl)benzoate.
| Compound Name | methyl 3-(5,6-dimethoxy-3-pyridinyl)benzoate |
|---|---|
| PubChem CID | 90046409 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | methyl 3-(5,6-dimethoxy-3-pyridinyl)benzoate |
| SMILES | COC(=O)c1cccc(-c2cnc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C15H15NO4/c1-18-13-8-12(9-16-14(13)19-2)10-5-4-6-11(7-10)15(17)20-3/h4-9H,1-3H3 |
| InChIKey | RVODTVYYJJDCFJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |