About (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one
(3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 90047014) has the molecular formula C6H9F3N2O
and a molecular weight of 182.14 g/mol. Its IUPAC name is (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one |
| PubChem CID | 90047014 |
| Molecular Formula | C6H9F3N2O |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | NC([C@@H]1CCNC1=O)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O/c7-6(8,9)4(10)3-1-2-11-5(3)12/h3-4H,1-2,10H2,(H,11,12)/t3-,4?/m0/s1 |
| InChIKey | XHPFYXFMCLOMFF-WUCPZUCCSA-N |
| XLogP | 0.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one?
The IUPAC name of (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one (CID 90047014) is (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one.
What is the SMILES notation for (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one?
The canonical SMILES for (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one is NC([C@@H]1CCNC1=O)C(F)(F)F.
What is the InChIKey of (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one?
The InChIKey is XHPFYXFMCLOMFF-WUCPZUCCSA-N. The full InChI is InChI=1S/C6H9F3N2O/c7-6(8,9)4(10)3-1-2-11-5(3)12/h3-4H,1-2,10H2,(H,11,12)/t3-,4?/m0/s1.
What are the key properties of (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one?
(3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one has a molecular weight of 182.14 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(1-amino-2,2,2-trifluoroethyl)pyrrolidin-2-one is sourced from PubChem (CID 90047014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).