C25H25NO3 — CID 90047724
ethyl 1-[4-[4-(pyridin-3-ylmethoxymethyl)phenyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 90047724) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 1-[4-[4-(pyridin-3-ylmethoxymethyl)phenyl]phenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[4-[4-(pyridin-3-ylmethoxymethyl)phenyl]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 90047724 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 1-[4-[4-(pyridin-3-ylmethoxymethyl)phenyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(-c3ccc(COCc4cccnc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H25NO3/c1-2-29-24(27)25(13-14-25)23-11-9-22(10-12-23)21-7-5-19(6-8-21)17-28-18-20-4-3-15-26-16-20/h3-12,15-16H,2,13-14,17-18H2,1H3 |
| InChIKey | ZALZPDAFQWCYAV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |