C19H23N — CID 90047806
9-(4-methylcyclohexa-1,5-dien-1-yl)-1,2,4b,5,8,8a-hexahydrocarbazole (PubChem CID 90047806) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 9-(4-methylcyclohexa-1,5-dien-1-yl)-1,2,4b,5,8,8a-hexahydrocarbazole.
| Compound Name | 9-(4-methylcyclohexa-1,5-dien-1-yl)-1,2,4b,5,8,8a-hexahydrocarbazole |
|---|---|
| PubChem CID | 90047806 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 9-(4-methylcyclohexa-1,5-dien-1-yl)-1,2,4b,5,8,8a-hexahydrocarbazole |
| SMILES | CC1C=CC(N2C3=C(C=CCC3)C3CC=CCC32)=CC1 |
| InChI | InChI=1S/C19H23N/c1-14-10-12-15(13-11-14)20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-4,7,10,12-14,16,18H,5-6,8-9,11H2,1H3 |
| InChIKey | JLNLQHIHADLCCV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|