About [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite
[2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite (PubChem CID 90048100) has the molecular formula C8H13F3INO3S
and a molecular weight of 387.16 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite.
Molecular Properties
| Compound Name | [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite |
| PubChem CID | 90048100 |
| Molecular Formula | C8H13F3INO3S |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite |
| SMILES | CS(=O)(=O)N1CCC(C(OI)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3INO3S/c1-17(14,15)13-4-2-6(3-5-13)7(16-12)8(9,10)11/h6-7H,2-5H2,1H3 |
| InChIKey | UAJRWWQWKCJCQS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite?
The IUPAC name of [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite (CID 90048100) is [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite.
What is the SMILES notation for [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite?
The canonical SMILES for [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite is CS(=O)(=O)N1CCC(C(OI)C(F)(F)F)CC1.
What is the InChIKey of [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite?
The InChIKey is UAJRWWQWKCJCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3INO3S/c1-17(14,15)13-4-2-6(3-5-13)7(16-12)8(9,10)11/h6-7H,2-5H2,1H3.
What are the key properties of [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite?
[2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite has a molecular weight of 387.16 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2,2-trifluoro-1-(1-methylsulfonylpiperidin-4-yl)ethyl] hypoiodite is sourced from PubChem (CID 90048100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).