About (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine
(1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine (PubChem CID 90048199) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine |
| PubChem CID | 90048199 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\C(F)=C/N)CC |
| InChI | InChI=1S/C8H12FN/c1-3-7(2)4-5-8(9)6-10/h4-6H,2-3,10H2,1H3/b5-4-,8-6+ |
| InChIKey | NVRIYSZOWFBNSK-GSGSLZOQSA-N |
| XLogP | 2.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine?
The IUPAC name of (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine (CID 90048199) is (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine.
What is the SMILES notation for (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine?
The canonical SMILES for (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine is C=C(/C=C\C(F)=C/N)CC.
What is the InChIKey of (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine?
The InChIKey is NVRIYSZOWFBNSK-GSGSLZOQSA-N. The full InChI is InChI=1S/C8H12FN/c1-3-7(2)4-5-8(9)6-10/h4-6H,2-3,10H2,1H3/b5-4-,8-6+.
What are the key properties of (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine?
(1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine has a molecular weight of 141.19 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-2-fluoro-5-methylidenehepta-1,3-dien-1-amine is sourced from PubChem (CID 90048199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).