About (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde
(7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 90048315) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde.
Molecular Properties
| Compound Name | (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde |
| PubChem CID | 90048315 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=CC1=CC2OCO[C@H]2C=C1 |
| InChI | InChI=1S/C8H8O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4,7-8H,5H2/t7-,8?/m0/s1 |
| InChIKey | JDYJUFQQZZCLLA-JAMMHHFISA-N |
| XLogP | 0.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde?
The IUPAC name of (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde (CID 90048315) is (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde.
What is the SMILES notation for (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde?
The canonical SMILES for (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde is O=CC1=CC2OCO[C@H]2C=C1.
What is the InChIKey of (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde?
The InChIKey is JDYJUFQQZZCLLA-JAMMHHFISA-N. The full InChI is InChI=1S/C8H8O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4,7-8H,5H2/t7-,8?/m0/s1.
What are the key properties of (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde?
(7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde has a molecular weight of 152.15 g/mol, XLogP of 0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7aS)-3a,7a-dihydro-1,3-benzodioxole-5-carbaldehyde is sourced from PubChem (CID 90048315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).