About 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide
5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide (PubChem CID 900484) has the molecular formula C11H18BrNO2S2
and a molecular weight of 340.31 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide |
| PubChem CID | 900484 |
| Molecular Formula | C11H18BrNO2S2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(C)C |
| InChI | InChI=1S/C11H18BrNO2S2/c1-7(2)11(8(3)4)13-17(14,15)10-6-5-9(12)16-10/h5-8,11,13H,1-4H3 |
| InChIKey | MDUGXTBQJBTFQW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide (CID 900484) is 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide is CC(C)C(NS(=O)(=O)c1ccc(Br)s1)C(C)C.
What is the InChIKey of 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide?
The InChIKey is MDUGXTBQJBTFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrNO2S2/c1-7(2)11(8(3)4)13-17(14,15)10-6-5-9(12)16-10/h5-8,11,13H,1-4H3.
What are the key properties of 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide?
5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide has a molecular weight of 340.31 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,4-dimethylpentan-3-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 900484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).