About N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine
N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine (PubChem CID 90048424) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine |
| PubChem CID | 90048424 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine |
| SMILES | CCNC1C=C(F)C(F)=CC1 |
| InChI | InChI=1S/C8H11F2N/c1-2-11-6-3-4-7(9)8(10)5-6/h4-6,11H,2-3H2,1H3 |
| InChIKey | VGDPVVMOYODCOM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine?
The IUPAC name of N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine (CID 90048424) is N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine is CCNC1C=C(F)C(F)=CC1.
What is the InChIKey of N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine?
The InChIKey is VGDPVVMOYODCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N/c1-2-11-6-3-4-7(9)8(10)5-6/h4-6,11H,2-3H2,1H3.
What are the key properties of N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine?
N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine has a molecular weight of 159.18 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4-difluorocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 90048424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).