C21H22N4O3S2 — CID 90048455
5-cyclopropyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(5-phenyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 90048455) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(5-phenyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(5-phenyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90048455 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 5-cyclopropyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(5-phenyl-1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CCCCNC(=O)c1nc(-c2ncc(-c3ccccc3)s2)sc1C1CC1)NO |
| InChI | InChI=1S/C21H22N4O3S2/c26-16(25-28)8-4-5-11-22-19(27)17-18(14-9-10-14)30-21(24-17)20-23-12-15(29-20)13-6-2-1-3-7-13/h1-3,6-7,12,14,28H,4-5,8-11H2,(H,22,27)(H,25,26) |
| InChIKey | ZCTMYLFBUPESPB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|