C16H20NO6S3+ — CID 90048987
7,8,8-trimethyl-6-propylthieno[3,2-e]indol-6-ium-2,4-disulfonic acid (PubChem CID 90048987) has the molecular formula C16H20NO6S3+ and a molecular weight of 418.54 g/mol. Its IUPAC name is 7,8,8-trimethyl-6-propylthieno[3,2-e]indol-6-ium-2,4-disulfonic acid.
| Compound Name | 7,8,8-trimethyl-6-propylthieno[3,2-e]indol-6-ium-2,4-disulfonic acid |
|---|---|
| PubChem CID | 90048987 |
| Molecular Formula | C16H20NO6S3+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 7,8,8-trimethyl-6-propylthieno[3,2-e]indol-6-ium-2,4-disulfonic acid |
| SMILES | CCC[N+]1=C(C)C(C)(C)c2c1cc(S(=O)(=O)O)c1sc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H19NO6S3/c1-5-6-17-9(2)16(3,4)14-10-7-13(26(21,22)23)24-15(10)12(8-11(14)17)25(18,19)20/h7-8H,5-6H2,1-4H3,(H-,18,19,20,21,22,23)/p+1 |
| InChIKey | GXDAOYWNWMWKFD-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|