About 2-(1,5-dimethylpyrazol-3-yl)ethyl formate
2-(1,5-dimethylpyrazol-3-yl)ethyl formate (PubChem CID 90049420) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-3-yl)ethyl formate.
Molecular Properties
| Compound Name | 2-(1,5-dimethylpyrazol-3-yl)ethyl formate |
| PubChem CID | 90049420 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-3-yl)ethyl formate |
| SMILES | Cc1cc(CCOC=O)nn1C |
| InChI | InChI=1S/C8H12N2O2/c1-7-5-8(9-10(7)2)3-4-12-6-11/h5-6H,3-4H2,1-2H3 |
| InChIKey | XTOIINHXAIKMJT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,5-dimethylpyrazol-3-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dimethylpyrazol-3-yl)ethyl formate?
The IUPAC name of 2-(1,5-dimethylpyrazol-3-yl)ethyl formate (CID 90049420) is 2-(1,5-dimethylpyrazol-3-yl)ethyl formate.
What is the SMILES notation for 2-(1,5-dimethylpyrazol-3-yl)ethyl formate?
The canonical SMILES for 2-(1,5-dimethylpyrazol-3-yl)ethyl formate is Cc1cc(CCOC=O)nn1C.
What is the InChIKey of 2-(1,5-dimethylpyrazol-3-yl)ethyl formate?
The InChIKey is XTOIINHXAIKMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-7-5-8(9-10(7)2)3-4-12-6-11/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-(1,5-dimethylpyrazol-3-yl)ethyl formate?
2-(1,5-dimethylpyrazol-3-yl)ethyl formate has a molecular weight of 168.20 g/mol, XLogP of 0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylpyrazol-3-yl)ethyl formate is sourced from PubChem (CID 90049420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).