About CID 90049683
CID 90049683 (PubChem CID 90049683) has the molecular formula C26H27BF3N6O2
and a molecular weight of 523.35 g/mol.
Molecular Properties
| Compound Name | CID 90049683 |
| PubChem CID | 90049683 |
| Molecular Formula | C26H27BF3N6O2 |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | — |
| SMILES | NC(=O)Cc1ccccc1CCc1nc(Nc2ccc(C3CCN([B]C=O)CC3)nc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H27BF3N6O2/c28-26(29,30)21-15-33-25(35-23(21)7-5-17-3-1-2-4-19(17)13-24(31)38)34-20-6-8-22(32-14-20)18-9-11-36(12-10-18)27-16-37/h1-4,6,8,14-16,18H,5,7,9-13H2,(H2,31,38)(H,33,34,35) |
| InChIKey | BXOLUADKMBTHNB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90049683 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90049683?
The IUPAC name of CID 90049683 (CID 90049683) is not available.
What is the SMILES notation for CID 90049683?
The canonical SMILES for CID 90049683 is NC(=O)Cc1ccccc1CCc1nc(Nc2ccc(C3CCN([B]C=O)CC3)nc2)ncc1C(F)(F)F.
What is the InChIKey of CID 90049683?
The InChIKey is BXOLUADKMBTHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27BF3N6O2/c28-26(29,30)21-15-33-25(35-23(21)7-5-17-3-1-2-4-19(17)13-24(31)38)34-20-6-8-22(32-14-20)18-9-11-36(12-10-18)27-16-37/h1-4,6,8,14-16,18H,5,7,9-13H2,(H2,31,38)(H,33,34,35).
What are the key properties of CID 90049683?
CID 90049683 has a molecular weight of 523.35 g/mol, XLogP of 3.44, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90049683 is sourced from PubChem (CID 90049683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).