C32H16F6N2O — CID 90049925
2-(4-dibenzofuran-2-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline (PubChem CID 90049925) has the molecular formula C32H16F6N2O and a molecular weight of 558.48 g/mol. Its IUPAC name is 2-(4-dibenzofuran-2-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline.
| Compound Name | 2-(4-dibenzofuran-2-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 90049925 |
| Molecular Formula | C32H16F6N2O |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-(4-dibenzofuran-2-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline |
| SMILES | FC(F)(F)c1ccnc2c1ccc1c(C(F)(F)F)cc(-c3ccc(-c4ccc5oc6ccccc6c5c4)cc3)nc12 |
| InChI | InChI=1S/C32H16F6N2O/c33-31(34,35)24-13-14-39-29-21(24)10-11-22-25(32(36,37)38)16-26(40-30(22)29)18-7-5-17(6-8-18)19-9-12-28-23(15-19)20-3-1-2-4-27(20)41-28/h1-16H |
| InChIKey | CMQUEAYYZCSXDQ-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|