About 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline
2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline (PubChem CID 90050102) has the molecular formula C32H16F6N2S
and a molecular weight of 574.55 g/mol. Its IUPAC name is 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline |
| PubChem CID | 90050102 |
| Molecular Formula | C32H16F6N2S |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline |
| SMILES | FC(F)(F)c1ccnc2c1ccc1c(C(F)(F)F)cc(-c3ccc(-c4cccc5c4sc4ccccc45)cc3)nc12 |
| InChI | InChI=1S/C32H16F6N2S/c33-31(34,35)24-14-15-39-28-22(24)12-13-23-25(32(36,37)38)16-26(40-29(23)28)18-10-8-17(9-11-18)19-5-3-6-21-20-4-1-2-7-27(20)41-30(19)21/h1-16H |
| InChIKey | UAPBKVNJUCUZGT-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline?
The IUPAC name of 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline (CID 90050102) is 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline.
What is the SMILES notation for 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline?
The canonical SMILES for 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline is FC(F)(F)c1ccnc2c1ccc1c(C(F)(F)F)cc(-c3ccc(-c4cccc5c4sc4ccccc45)cc3)nc12.
What is the InChIKey of 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline?
The InChIKey is UAPBKVNJUCUZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H16F6N2S/c33-31(34,35)24-14-15-39-28-22(24)12-13-23-25(32(36,37)38)16-26(40-29(23)28)18-10-8-17(9-11-18)19-5-3-6-21-20-4-1-2-7-27(20)41-30(19)21/h1-16H.
What are the key properties of 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline?
2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline has a molecular weight of 574.55 g/mol, XLogP of 10.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-dibenzothiophen-4-ylphenyl)-4,7-bis(trifluoromethyl)-1,10-phenanthroline is sourced from PubChem (CID 90050102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).