C12H12N2 — CID 90050512
1,2,6a,7-tetrahydro-1,10-phenanthroline (PubChem CID 90050512) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,2,6a,7-tetrahydro-1,10-phenanthroline.
| Compound Name | 1,2,6a,7-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 90050512 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,2,6a,7-tetrahydro-1,10-phenanthroline |
| SMILES | C1=CC2=C(NC1)C1=NC=CCC1C=C2 |
| InChI | InChI=1S/C12H12N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-3,5-6,8,10,13H,4,7H2 |
| InChIKey | XDYAQVPWDUVKQK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |