About 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile
3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile (PubChem CID 90050584) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile |
| PubChem CID | 90050584 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile |
| SMILES | N#CCC(N)c1cc(=O)o[nH]1 |
| InChI | InChI=1S/C6H7N3O2/c7-2-1-4(8)5-3-6(10)11-9-5/h3-4,9H,1,8H2 |
| InChIKey | VOQBQCSHMGVIJL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile?
The IUPAC name of 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile (CID 90050584) is 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile.
What is the SMILES notation for 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile?
The canonical SMILES for 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile is N#CCC(N)c1cc(=O)o[nH]1.
What is the InChIKey of 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile?
The InChIKey is VOQBQCSHMGVIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c7-2-1-4(8)5-3-6(10)11-9-5/h3-4,9H,1,8H2.
What are the key properties of 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile?
3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile has a molecular weight of 153.14 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(5-oxo-2H-1,2-oxazol-3-yl)propanenitrile is sourced from PubChem (CID 90050584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).