C29H25F3N4O4 — CID 90050663
N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-3H-1-benzofuran]-5'-carboxamide (PubChem CID 90050663) has the molecular formula C29H25F3N4O4 and a molecular weight of 550.54 g/mol. Its IUPAC name is N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-3H-1-benzofuran]-5'-carboxamide.
| Compound Name | N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-3H-1-benzofuran]-5'-carboxamide |
|---|---|
| PubChem CID | 90050663 |
| Molecular Formula | C29H25F3N4O4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,2'-3H-1-benzofuran]-5'-carboxamide |
| SMILES | C[C@@H]1[C@H](c2ccccc2)C[C@H](NC(=O)c2ccc3c(c2)CC2(O3)C(=O)Nc3ncccc32)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C29H25F3N4O4/c1-16-20(17-6-3-2-4-7-17)13-22(26(38)36(16)15-29(30,31)32)34-25(37)18-9-10-23-19(12-18)14-28(40-23)21-8-5-11-33-24(21)35-27(28)39/h2-12,16,20,22H,13-15H2,1H3,(H,34,37)(H,33,35,39)/t16-,20-,22+,28?/m1/s1 |
| InChIKey | FLIDVDHQVHAMRL-HZNJDMCASA-N |
| XLogP | 3.93 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |