About 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine
4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 90051024) has the molecular formula C22H25N
and a molecular weight of 303.45 g/mol. Its IUPAC name is 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
| PubChem CID | 90051024 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | Cc1cnc(C2=CC(c3ccccc3)=CCC2C(C)C)cc1C |
| InChI | InChI=1S/C22H25N/c1-15(2)20-11-10-19(18-8-6-5-7-9-18)13-21(20)22-12-16(3)17(4)14-23-22/h5-10,12-15,20H,11H2,1-4H3 |
| InChIKey | QBCHZRSNMYFDIM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The IUPAC name of 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine (CID 90051024) is 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine.
What is the SMILES notation for 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The canonical SMILES for 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine is Cc1cnc(C2=CC(c3ccccc3)=CCC2C(C)C)cc1C.
What is the InChIKey of 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The InChIKey is QBCHZRSNMYFDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N/c1-15(2)20-11-10-19(18-8-6-5-7-9-18)13-21(20)22-12-16(3)17(4)14-23-22/h5-10,12-15,20H,11H2,1-4H3.
What are the key properties of 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine has a molecular weight of 303.45 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(3-phenyl-6-propan-2-ylcyclohexa-1,3-dien-1-yl)pyridine is sourced from PubChem (CID 90051024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).