C18H17FN4O3 — CID 90051100
11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 90051100) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 90051100 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]ccc4c3N(C)C2=O)c1 |
| InChI | InChI=1S/C18H17FN4O3/c1-22-16-10(8-21-17-12(16)4-5-20-17)9-23(18(22)24)13-6-11(25-2)7-14(26-3)15(13)19/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | UQZPQFKVJWOQTM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |