About 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene
2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene (PubChem CID 90051138) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene |
| PubChem CID | 90051138 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene |
| SMILES | C1=CC(CNNNC2=CCCC=C2)=CCC1 |
| InChI | InChI=1S/C13H19N3/c1-3-7-12(8-4-1)11-14-16-15-13-9-5-2-6-10-13/h3,5,7-10,14-16H,1-2,4,6,11H2 |
| InChIKey | FUNJILMUHZJIMN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene?
The IUPAC name of 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene (CID 90051138) is 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene.
What is the SMILES notation for 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene?
The canonical SMILES for 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene is C1=CC(CNNNC2=CCCC=C2)=CCC1.
What is the InChIKey of 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene?
The InChIKey is FUNJILMUHZJIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-7-12(8-4-1)11-14-16-15-13-9-5-2-6-10-13/h3,5,7-10,14-16H,1-2,4,6,11H2.
What are the key properties of 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene?
2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene has a molecular weight of 217.32 g/mol, XLogP of 2.10, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(cyclohexa-1,5-dien-1-ylamino)hydrazinyl]methyl]cyclohexa-1,3-diene is sourced from PubChem (CID 90051138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).