About [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine
[(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine (PubChem CID 90051191) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine.
Molecular Properties
| Compound Name | [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine |
| PubChem CID | 90051191 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine |
| SMILES | NNC(/C=C/C1C=CCCC1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H22N2/c16-17-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h3,5,7,9-13,15,17H,1-2,4,6,8,16H2/b12-11+ |
| InChIKey | MZCNBGCLLCRUIR-VAWYXSNFSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine?
The IUPAC name of [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine (CID 90051191) is [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine.
What is the SMILES notation for [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine?
The canonical SMILES for [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine is NNC(/C=C/C1C=CCCC1)C1=CCCC=C1.
What is the InChIKey of [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine?
The InChIKey is MZCNBGCLLCRUIR-VAWYXSNFSA-N. The full InChI is InChI=1S/C15H22N2/c16-17-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h3,5,7,9-13,15,17H,1-2,4,6,8,16H2/b12-11+.
What are the key properties of [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine?
[(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine has a molecular weight of 230.35 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-cyclohexa-1,5-dien-1-yl-3-cyclohex-2-en-1-ylprop-2-enyl]hydrazine is sourced from PubChem (CID 90051191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).