C21H20F2N4O5 — CID 90051210
(2S)-2-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-8-oxo-6,9-dihydropyrrolo[2,3-c][2,7]naphthyridin-3-yl]amino]-3-hydroxypropanal (PubChem CID 90051210) has the molecular formula C21H20F2N4O5 and a molecular weight of 446.41 g/mol. Its IUPAC name is (2S)-2-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-8-oxo-6,9-dihydropyrrolo[2,3-c][2,7]naphthyridin-3-yl]amino]-3-hydroxypropanal.
| Compound Name | (2S)-2-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-8-oxo-6,9-dihydropyrrolo[2,3-c][2,7]naphthyridin-3-yl]amino]-3-hydroxypropanal |
|---|---|
| PubChem CID | 90051210 |
| Molecular Formula | C21H20F2N4O5 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (2S)-2-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-8-oxo-6,9-dihydropyrrolo[2,3-c][2,7]naphthyridin-3-yl]amino]-3-hydroxypropanal |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(ccn4N[C@H](C=O)CO)c3CC2=O)c1F |
| InChI | InChI=1S/C21H20F2N4O5/c1-31-15-6-16(32-2)19(23)20(18(15)22)26-8-11-7-24-21-13(14(11)5-17(26)30)3-4-27(21)25-12(9-28)10-29/h3-4,6-7,9,12,25,29H,5,8,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | JHTVADXPIQNDNF-GFCCVEGCSA-N |
| XLogP | 1.52 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|