C14H22F2O — CID 90051411
(2Z,5Z)-3-(difluoromethyl)-4-methylidene-2-[(2R)-pentan-2-yl]oxyhepta-2,5-diene (PubChem CID 90051411) has the molecular formula C14H22F2O and a molecular weight of 244.32 g/mol. Its IUPAC name is (2Z,5Z)-3-(difluoromethyl)-4-methylidene-2-[(2R)-pentan-2-yl]oxyhepta-2,5-diene.
| Compound Name | (2Z,5Z)-3-(difluoromethyl)-4-methylidene-2-[(2R)-pentan-2-yl]oxyhepta-2,5-diene |
|---|---|
| PubChem CID | 90051411 |
| Molecular Formula | C14H22F2O |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2Z,5Z)-3-(difluoromethyl)-4-methylidene-2-[(2R)-pentan-2-yl]oxyhepta-2,5-diene |
| SMILES | C=C(/C=C\C)/C(=C(\C)O[C@H](C)CCC)C(F)F |
| InChI | InChI=1S/C14H22F2O/c1-6-8-10(3)13(14(15)16)12(5)17-11(4)9-7-2/h6,8,11,14H,3,7,9H2,1-2,4-5H3/b8-6-,13-12-/t11-/m1/s1 |
| InChIKey | QQFBYEJXCAWDRD-DZARDZFBSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|