C22H23N3O6S — CID 90051595
2-(2,5-dimethoxy-N-(4-methoxyphenyl)sulfonylanilino)-N-pyridin-4-ylacetamide (PubChem CID 90051595) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-(4-methoxyphenyl)sulfonylanilino)-N-pyridin-4-ylacetamide.
| Compound Name | 2-(2,5-dimethoxy-N-(4-methoxyphenyl)sulfonylanilino)-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 90051595 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-(2,5-dimethoxy-N-(4-methoxyphenyl)sulfonylanilino)-N-pyridin-4-ylacetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccncc2)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-29-17-4-7-19(8-5-17)32(27,28)25(15-22(26)24-16-10-12-23-13-11-16)20-14-18(30-2)6-9-21(20)31-3/h4-14H,15H2,1-3H3,(H,23,24,26) |
| InChIKey | FINTXCCHJYVXMV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |