C19H24FN5O — CID 90051669
3-[(2E,4Z)-1-fluoro-6-(3-imidazol-1-ylpropylamino)hepta-2,4,6-trien-3-yl]-2,6-dimethylpyrimidin-4-one (PubChem CID 90051669) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[(2E,4Z)-1-fluoro-6-(3-imidazol-1-ylpropylamino)hepta-2,4,6-trien-3-yl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[(2E,4Z)-1-fluoro-6-(3-imidazol-1-ylpropylamino)hepta-2,4,6-trien-3-yl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 90051669 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-[(2E,4Z)-1-fluoro-6-(3-imidazol-1-ylpropylamino)hepta-2,4,6-trien-3-yl]-2,6-dimethylpyrimidin-4-one |
| SMILES | C=C(/C=C\C(=C/CF)n1c(C)nc(C)cc1=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C19H24FN5O/c1-15(22-9-4-11-24-12-10-21-14-24)5-6-18(7-8-20)25-17(3)23-16(2)13-19(25)26/h5-7,10,12-14,22H,1,4,8-9,11H2,2-3H3/b6-5-,18-7+ |
| InChIKey | FYSIZLJCYSKISS-GTSVLJIISA-N |
| XLogP | 2.62 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|