C26H38N8O2S — CID 90051997
(E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide (PubChem CID 90051997) has the molecular formula C26H38N8O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 90051997 |
| Molecular Formula | C26H38N8O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(3-methyl-1,2-thiazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2cc(C)ns2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C26H38N8O2S/c1-7-14-27-24-21(18-29-26(31-24)30-22-17-19(2)32-37-22)12-9-8-10-15-28-25(36)20(3)34(6)23(35)13-11-16-33(4)5/h11,13,17-18,20H,7-8,10,14-16H2,1-6H3,(H,28,36)(H2,27,29,30,31)/b13-11+/t20-/m0/s1 |
| InChIKey | YZQZZODAVCMBKD-RPAADVPWSA-N |
| XLogP | 3.02 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|