C17H13FIN3O — CID 90052148
N-(3-fluorophenyl)-5-iodo-4-phenylmethoxypyrimidin-2-amine (PubChem CID 90052148) has the molecular formula C17H13FIN3O and a molecular weight of 421.21 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-iodo-4-phenylmethoxypyrimidin-2-amine.
| Compound Name | N-(3-fluorophenyl)-5-iodo-4-phenylmethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 90052148 |
| Molecular Formula | C17H13FIN3O |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | N-(3-fluorophenyl)-5-iodo-4-phenylmethoxypyrimidin-2-amine |
| SMILES | Fc1cccc(Nc2ncc(I)c(OCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C17H13FIN3O/c18-13-7-4-8-14(9-13)21-17-20-10-15(19)16(22-17)23-11-12-5-2-1-3-6-12/h1-10H,11H2,(H,20,21,22) |
| InChIKey | MOVGANFIMUWROC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|