C23H32N8O3 — CID 90052167
N-[3-[[2-(prop-2-enoylamino)acetyl]amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 90052167) has the molecular formula C23H32N8O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[3-[[2-(prop-2-enoylamino)acetyl]amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[3-[[2-(prop-2-enoylamino)acetyl]amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90052167 |
| Molecular Formula | C23H32N8O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N-[3-[[2-(prop-2-enoylamino)acetyl]amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)NCC(=O)NCCCNC(=O)c1cnc(NCCc2ccncc2)nc1NCCC |
| InChI | InChI=1S/C23H32N8O3/c1-3-9-26-21-18(15-30-23(31-21)28-14-8-17-6-12-24-13-7-17)22(34)27-11-5-10-25-20(33)16-29-19(32)4-2/h4,6-7,12-13,15H,2-3,5,8-11,14,16H2,1H3,(H,25,33)(H,27,34)(H,29,32)(H2,26,28,30,31) |
| InChIKey | ZFDNJPJMICQNOU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|